C18H22F5NO2 — CID 172585858
4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3,5-difluorobenzoic acid;ethane (PubChem CID 172585858) has the molecular formula C18H22F5NO2 and a molecular weight of 379.37 g/mol. Its IUPAC name is 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3,5-difluorobenzoic acid;ethane.
| Compound Name | 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3,5-difluorobenzoic acid;ethane |
|---|---|
| PubChem CID | 172585858 |
| Molecular Formula | C18H22F5NO2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3,5-difluorobenzoic acid;ethane |
| SMILES | C/C=C(\N=C(\c1c(F)cc(C(=O)O)cc1F)C(C)CC)C(F)(F)F.CC |
| InChI | InChI=1S/C16H16F5NO2.C2H6/c1-4-8(3)14(22-12(5-2)16(19,20)21)13-10(17)6-9(15(23)24)7-11(13)18;1-2/h5-8H,4H2,1-3H3,(H,23,24);1-2H3/b12-5-,22-14+; |
| InChIKey | HDJXWFVVUMFNIA-GLZVIKSNSA-N |
| XLogP | 5.99 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|