About 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde
4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde (PubChem CID 172585870) has the molecular formula C16H17F4NO
and a molecular weight of 315.31 g/mol. Its IUPAC name is 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde.
Molecular Properties
| Compound Name | 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde |
| PubChem CID | 172585870 |
| Molecular Formula | C16H17F4NO |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde |
| SMILES | C/C=C(\N=C(\c1ccc(C=O)cc1F)C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C16H17F4NO/c1-4-10(3)15(21-14(5-2)16(18,19)20)12-7-6-11(9-22)8-13(12)17/h5-10H,4H2,1-3H3/b14-5-,21-15+ |
| InChIKey | SHVTZQBQIMPIQT-IYHYWARKSA-N |
| XLogP | 4.94 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde?
The IUPAC name of 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde (CID 172585870) is 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde.
What is the SMILES notation for 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde?
The canonical SMILES for 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde is C/C=C(\N=C(\c1ccc(C=O)cc1F)C(C)CC)C(F)(F)F.
What is the InChIKey of 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde?
The InChIKey is SHVTZQBQIMPIQT-IYHYWARKSA-N. The full InChI is InChI=1S/C16H17F4NO/c1-4-10(3)15(21-14(5-2)16(18,19)20)12-7-6-11(9-22)8-13(12)17/h5-10H,4H2,1-3H3/b14-5-,21-15+.
What are the key properties of 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde?
4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde has a molecular weight of 315.31 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-fluorobenzaldehyde is sourced from PubChem (CID 172585870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).