About 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen
1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen (PubChem CID 172585871) has the molecular formula C16H17F2NO
and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen.
Molecular Properties
| Compound Name | 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen |
| PubChem CID | 172585871 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen |
| SMILES | C=C1CC=C(C(C)(F)F)N=C1c1ccc(C(C)=O)cc1.[H][H] |
| InChI | InChI=1S/C16H15F2NO.H2/c1-10-4-9-14(16(3,17)18)19-15(10)13-7-5-12(6-8-13)11(2)20;/h5-9H,1,4H2,2-3H3;1H |
| InChIKey | OKXBRIQOMQEVQH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen?
The IUPAC name of 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen (CID 172585871) is 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen.
What is the SMILES notation for 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen?
The canonical SMILES for 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen is C=C1CC=C(C(C)(F)F)N=C1c1ccc(C(C)=O)cc1.[H][H].
What is the InChIKey of 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen?
The InChIKey is OKXBRIQOMQEVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO.H2/c1-10-4-9-14(16(3,17)18)19-15(10)13-7-5-12(6-8-13)11(2)20;/h5-9H,1,4H2,2-3H3;1H.
What are the key properties of 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen?
1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen has a molecular weight of 277.31 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[6-(1,1-difluoroethyl)-3-methylidene-4H-pyridin-2-yl]phenyl]ethanone;molecular hydrogen is sourced from PubChem (CID 172585871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).