C19H30F3NO — CID 172585991
ethane;1-[4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]ethanol;propane (PubChem CID 172585991) has the molecular formula C19H30F3NO and a molecular weight of 345.45 g/mol. Its IUPAC name is ethane;1-[4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]ethanol;propane.
| Compound Name | ethane;1-[4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]ethanol;propane |
|---|---|
| PubChem CID | 172585991 |
| Molecular Formula | C19H30F3NO |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | ethane;1-[4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]ethanol;propane |
| SMILES | C/C=C(\N=C(/C)c1ccc(C(C)O)cc1)C(F)(F)F.CC.CCC |
| InChI | InChI=1S/C14H16F3NO.C3H8.C2H6/c1-4-13(14(15,16)17)18-9(2)11-5-7-12(8-6-11)10(3)19;1-3-2;1-2/h4-8,10,19H,1-3H3;3H2,1-2H3;1-2H3/b13-4-,18-9+;; |
| InChIKey | UKPNGJPEAZMLQY-WCRJRXIRSA-N |
| XLogP | 6.46 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|