C31H33F2IN5O3- — CID 172586455
CID 172586455 (PubChem CID 172586455) has the molecular formula C31H33F2IN5O3- and a molecular weight of 688.54 g/mol.
| Compound Name | CID 172586455 |
|---|---|
| PubChem CID | 172586455 |
| Molecular Formula | C31H33F2IN5O3- |
| Molecular Weight | 688.54 g/mol |
| Exact Mass | 688.16 |
| IUPAC Name | — |
| SMILES | C=C(C)C(F)(F)C1=CN(C)C(c2ccc(COc3nc(-c4c(OC)ncnc4C4CC4)ncc3OC(C)C)cc2)=C[I-]1 |
| InChI | InChI=1S/C31H33F2IN5O3/c1-18(2)31(32,33)25-15-39(5)23(13-34-25)21-9-7-20(8-10-21)16-41-29-24(42-19(3)4)14-35-28(38-29)26-27(22-11-12-22)36-17-37-30(26)40-6/h7-10,13-15,17,19,22H,1,11-12,16H2,2-6H3/q-1 |
| InChIKey | KYBSDQXKNWSYNX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|