C38H67NO13 — CID 172587641
[2-[4-[[4-[1-formyloxy-3-(2-methyloctanoyloxy)propan-2-yl]oxy-4-oxobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoyloxy]-3-hydroxypropyl] 2-methyloctanoate (PubChem CID 172587641) has the molecular formula C38H67NO13 and a molecular weight of 745.95 g/mol. Its IUPAC name is [2-[4-[[4-[1-formyloxy-3-(2-methyloctanoyloxy)propan-2-yl]oxy-4-oxobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoyloxy]-3-hydroxypropyl] 2-methyloctanoate.
| Compound Name | [2-[4-[[4-[1-formyloxy-3-(2-methyloctanoyloxy)propan-2-yl]oxy-4-oxobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoyloxy]-3-hydroxypropyl] 2-methyloctanoate |
|---|---|
| PubChem CID | 172587641 |
| Molecular Formula | C38H67NO13 |
| Molecular Weight | 745.95 g/mol |
| Exact Mass | 745.46 |
| IUPAC Name | [2-[4-[[4-[1-formyloxy-3-(2-methyloctanoyloxy)propan-2-yl]oxy-4-oxobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoyloxy]-3-hydroxypropyl] 2-methyloctanoate |
| SMILES | CCCCCCC(C)C(=O)OCC(CO)OC(=O)CCCN(CCCC(=O)OC(COC=O)COC(=O)C(C)CCCCCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H67NO13/c1-8-10-12-14-18-29(3)35(44)48-26-31(24-40)50-33(42)20-16-22-39(37(46)52-38(5,6)7)23-17-21-34(43)51-32(25-47-28-41)27-49-36(45)30(4)19-15-13-11-9-2/h28-32,40H,8-27H2,1-7H3 |
| InChIKey | CJEHQWUWNOFREI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.95 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|