About 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one
6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one (PubChem CID 172588871) has the molecular formula C16H18ClNO6
and a molecular weight of 355.77 g/mol. Its IUPAC name is 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one.
Molecular Properties
| Compound Name | 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one |
| PubChem CID | 172588871 |
| Molecular Formula | C16H18ClNO6 |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one |
| SMILES | COCCOc1c(-c2c(OC)cncc2OC)cc(CCl)oc1=O |
| InChI | InChI=1S/C16H18ClNO6/c1-20-4-5-23-15-11(6-10(7-17)24-16(15)19)14-12(21-2)8-18-9-13(14)22-3/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | XISFGSDBKGVAIV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one?
The IUPAC name of 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one (CID 172588871) is 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one.
What is the SMILES notation for 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one?
The canonical SMILES for 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one is COCCOc1c(-c2c(OC)cncc2OC)cc(CCl)oc1=O.
What is the InChIKey of 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one?
The InChIKey is XISFGSDBKGVAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClNO6/c1-20-4-5-23-15-11(6-10(7-17)24-16(15)19)14-12(21-2)8-18-9-13(14)22-3/h6,8-9H,4-5,7H2,1-3H3.
What are the key properties of 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one?
6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one has a molecular weight of 355.77 g/mol, XLogP of 2.48, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-4-(3,5-dimethoxy-4-pyridinyl)-3-(2-methoxyethoxy)pyran-2-one is sourced from PubChem (CID 172588871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).