About 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol
2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol (PubChem CID 172590096) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol.
Molecular Properties
| Compound Name | 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol |
| PubChem CID | 172590096 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol |
| SMILES | C=C(/C=C\C)N1CCN(CCCCNCCO)CC1 |
| InChI | InChI=1S/C15H29N3O/c1-3-6-15(2)18-12-10-17(11-13-18)9-5-4-7-16-8-14-19/h3,6,16,19H,2,4-5,7-14H2,1H3/b6-3- |
| InChIKey | WUNPJENEMFBSJV-UTCJRWHESA-N |
| XLogP | 1.06 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol?
The IUPAC name of 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol (CID 172590096) is 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol.
What is the SMILES notation for 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol?
The canonical SMILES for 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol is C=C(/C=C\C)N1CCN(CCCCNCCO)CC1.
What is the InChIKey of 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol?
The InChIKey is WUNPJENEMFBSJV-UTCJRWHESA-N. The full InChI is InChI=1S/C15H29N3O/c1-3-6-15(2)18-12-10-17(11-13-18)9-5-4-7-16-8-14-19/h3,6,16,19H,2,4-5,7-14H2,1H3/b6-3-.
What are the key properties of 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol?
2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol has a molecular weight of 267.42 g/mol, XLogP of 1.06, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-[(3Z)-penta-1,3-dien-2-yl]piperazin-1-yl]butylamino]ethanol is sourced from PubChem (CID 172590096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).