About ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one
ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one (PubChem CID 172591285) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one |
| PubChem CID | 172591285 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one |
| SMILES | C=C/C=c1/oc(=O)n(C)/c1=C/CC.CC.CC |
| InChI | InChI=1S/C10H13NO2.2C2H6/c1-4-6-8-9(7-5-2)13-10(12)11(8)3;2*1-2/h5-7H,2,4H2,1,3H3;2*1-2H3/b8-6+,9-7+;; |
| InChIKey | XXQLYFCQULHFAI-IWBCLEKBSA-N |
| XLogP | 2.19 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one?
The IUPAC name of ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one (CID 172591285) is ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one.
What is the SMILES notation for ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one?
The canonical SMILES for ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one is C=C/C=c1/oc(=O)n(C)/c1=C/CC.CC.CC.
What is the InChIKey of ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one?
The InChIKey is XXQLYFCQULHFAI-IWBCLEKBSA-N. The full InChI is InChI=1S/C10H13NO2.2C2H6/c1-4-6-8-9(7-5-2)13-10(12)11(8)3;2*1-2/h5-7H,2,4H2,1,3H3;2*1-2H3/b8-6+,9-7+;;.
What are the key properties of ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one?
ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one has a molecular weight of 239.36 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4E,5E)-3-methyl-5-prop-2-enylidene-4-propylidene-1,3-oxazolidin-2-one is sourced from PubChem (CID 172591285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).