C12H18BrNO — CID 172591871
1-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]piperidin-4-ol (PubChem CID 172591871) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]piperidin-4-ol.
| Compound Name | 1-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 172591871 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]piperidin-4-ol |
| SMILES | C=C/C(=C\C(Br)=C/C)N1CCC(O)CC1 |
| InChI | InChI=1S/C12H18BrNO/c1-3-10(13)9-11(4-2)14-7-5-12(15)6-8-14/h3-4,9,12,15H,2,5-8H2,1H3/b10-3+,11-9+ |
| InChIKey | AYPDOEZBOZBFBT-LHLSIBMCSA-N |
| XLogP | 2.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|