C17H19BFNO3 — CID 172591879
1-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 172591879) has the molecular formula C17H19BFNO3 and a molecular weight of 315.15 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 1-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 172591879 |
| Molecular Formula | C17H19BFNO3 |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | CC1(C)OB(c2ccc(=O)n(-c3ccc(F)cc3)c2)OC1(C)C |
| InChI | InChI=1S/C17H19BFNO3/c1-16(2)17(3,4)23-18(22-16)12-5-10-15(21)20(11-12)14-8-6-13(19)7-9-14/h5-11H,1-4H3 |
| InChIKey | JQRVSCSTZFHHNR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|