C16H24FN5O2 — CID 172592025
N-[4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]acetamide (PubChem CID 172592025) has the molecular formula C16H24FN5O2 and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]acetamide.
| Compound Name | N-[4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 172592025 |
| Molecular Formula | C16H24FN5O2 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(Nc2ncc(F)c(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C16H24FN5O2/c1-11(23)19-12-2-4-13(5-3-12)20-16-18-10-14(17)15(21-16)22-6-8-24-9-7-22/h10,12-13H,2-9H2,1H3,(H,19,23)(H,18,20,21) |
| InChIKey | XJWMAXIHFSGVKT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |