C29H36FN5O3 — CID 172592239
cyclohexylmethyl 4-[[5-fluoro-4-[3-[[(2Z,4Z)-hexa-2,4-dienoyl]amino]phenyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 172592239) has the molecular formula C29H36FN5O3 and a molecular weight of 521.64 g/mol. Its IUPAC name is cyclohexylmethyl 4-[[5-fluoro-4-[3-[[(2Z,4Z)-hexa-2,4-dienoyl]amino]phenyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | cyclohexylmethyl 4-[[5-fluoro-4-[3-[[(2Z,4Z)-hexa-2,4-dienoyl]amino]phenyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172592239 |
| Molecular Formula | C29H36FN5O3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | cyclohexylmethyl 4-[[5-fluoro-4-[3-[[(2Z,4Z)-hexa-2,4-dienoyl]amino]phenyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | C/C=C\C=C/C(=O)Nc1cccc(-c2nc(NC3CCN(C(=O)OCC4CCCCC4)CC3)ncc2F)c1 |
| InChI | InChI=1S/C29H36FN5O3/c1-2-3-5-13-26(36)32-24-12-8-11-22(18-24)27-25(30)19-31-28(34-27)33-23-14-16-35(17-15-23)29(37)38-20-21-9-6-4-7-10-21/h2-3,5,8,11-13,18-19,21,23H,4,6-7,9-10,14-17,20H2,1H3,(H,32,36)(H,31,33,34)/b3-2-,13-5- |
| InChIKey | ZKAODXPSJSJOGQ-WUCWQLRMSA-N |
| XLogP | 5.95 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|