C13H20FN3 — CID 172592436
4-(3-cyclopropylcyclohex-2-en-1-yl)-5-fluoro-1,2,3,4-tetrahydropyrimidin-2-amine (PubChem CID 172592436) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-(3-cyclopropylcyclohex-2-en-1-yl)-5-fluoro-1,2,3,4-tetrahydropyrimidin-2-amine.
| Compound Name | 4-(3-cyclopropylcyclohex-2-en-1-yl)-5-fluoro-1,2,3,4-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 172592436 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 4-(3-cyclopropylcyclohex-2-en-1-yl)-5-fluoro-1,2,3,4-tetrahydropyrimidin-2-amine |
| SMILES | NC1NC=C(F)C(C2C=C(C3CC3)CCC2)N1 |
| InChI | InChI=1S/C13H20FN3/c14-11-7-16-13(15)17-12(11)10-3-1-2-9(6-10)8-4-5-8/h6-8,10,12-13,16-17H,1-5,15H2 |
| InChIKey | BLYSOWIUOZBRAL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|