C29H35F4N7O2Si — CID 172592958
2-[[2-[(2S,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methylmorpholin-4-yl]-6-[2-fluoro-4-(trifluoromethyl)phenyl]purin-9-yl]methoxy]ethyl-trimethylsilane (PubChem CID 172592958) has the molecular formula C29H35F4N7O2Si and a molecular weight of 617.72 g/mol. Its IUPAC name is 2-[[2-[(2S,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methylmorpholin-4-yl]-6-[2-fluoro-4-(trifluoromethyl)phenyl]purin-9-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[(2S,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methylmorpholin-4-yl]-6-[2-fluoro-4-(trifluoromethyl)phenyl]purin-9-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 172592958 |
| Molecular Formula | C29H35F4N7O2Si |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 2-[[2-[(2S,6R)-2-(1-cyclopropylpyrazol-4-yl)-6-methylmorpholin-4-yl]-6-[2-fluoro-4-(trifluoromethyl)phenyl]purin-9-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[C@@H]1CN(c2nc(-c3ccc(C(F)(F)F)cc3F)c3ncn(COCC[Si](C)(C)C)c3n2)C[C@H](c2cnn(C3CC3)c2)O1 |
| InChI | InChI=1S/C29H35F4N7O2Si/c1-18-13-38(15-24(42-18)19-12-35-40(14-19)21-6-7-21)28-36-25(22-8-5-20(11-23(22)30)29(31,32)33)26-27(37-28)39(16-34-26)17-41-9-10-43(2,3)4/h5,8,11-12,14,16,18,21,24H,6-7,9-10,13,15,17H2,1-4H3/t18-,24-/m1/s1 |
| InChIKey | QEOFUFQGDXRCMX-HOYKHHGWSA-N |
| XLogP | 6.46 |
| TPSA | 83.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|