About ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane
ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane (PubChem CID 172593049) has the molecular formula C19H36F3NO3
and a molecular weight of 383.50 g/mol. Its IUPAC name is ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane.
Molecular Properties
| Compound Name | ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane |
| PubChem CID | 172593049 |
| Molecular Formula | C19H36F3NO3 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane |
| SMILES | CCCCC.CCOC.[H]/N=C(/C(C(=O)OCC)=C(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO2.C5H12.C3H8O/c1-4-7(5-2)8(10(16)17-6-3)9(15)11(12,13)14;1-3-5-4-2;1-3-4-2/h15H,4-6H2,1-3H3;3-5H2,1-2H3;3H2,1-2H3/b15-9-;; |
| InChIKey | FWAJNMIZUHQFCE-OCVBWICTSA-N |
| XLogP | 6.10 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane?
The IUPAC name of ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane (CID 172593049) is ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane.
What is the SMILES notation for ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane?
The canonical SMILES for ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane is CCCCC.CCOC.[H]/N=C(/C(C(=O)OCC)=C(CC)CC)C(F)(F)F.
What is the InChIKey of ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane?
The InChIKey is FWAJNMIZUHQFCE-OCVBWICTSA-N. The full InChI is InChI=1S/C11H16F3NO2.C5H12.C3H8O/c1-4-7(5-2)8(10(16)17-6-3)9(15)11(12,13)14;1-3-5-4-2;1-3-4-2/h15H,4-6H2,1-3H3;3-5H2,1-2H3;3H2,1-2H3/b15-9-;;.
What are the key properties of ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane?
ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane has a molecular weight of 383.50 g/mol, XLogP of 6.10, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate;methoxyethane;pentane is sourced from PubChem (CID 172593049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).