C18H34 — CID 172595101
ethane;(5Z,7Z)-2,5,7-trimethyl-4-methylidenedeca-2,5,7-triene (PubChem CID 172595101) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is ethane;(5Z,7Z)-2,5,7-trimethyl-4-methylidenedeca-2,5,7-triene.
| Compound Name | ethane;(5Z,7Z)-2,5,7-trimethyl-4-methylidenedeca-2,5,7-triene |
|---|---|
| PubChem CID | 172595101 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | ethane;(5Z,7Z)-2,5,7-trimethyl-4-methylidenedeca-2,5,7-triene |
| SMILES | C=C(C=C(C)C)/C(C)=C\C(C)=C/CC.CC.CC |
| InChI | InChI=1S/C14H22.2C2H6/c1-7-8-12(4)10-14(6)13(5)9-11(2)3;2*1-2/h8-10H,5,7H2,1-4,6H3;2*1-2H3/b12-8-,14-10-;; |
| InChIKey | SJGXBGBBCJHWDS-ODEJAHFGSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|