About (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide
(3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 172595559) has the molecular formula C12H17F2NO
and a molecular weight of 229.27 g/mol. Its IUPAC name is (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 172595559 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CCCN(CC)C(=O)C1=C(F)[C@@H](F)CC=C1 |
| InChI | InChI=1S/C12H17F2NO/c1-3-8-15(4-2)12(16)9-6-5-7-10(13)11(9)14/h5-6,10H,3-4,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | IMZGXJVHUYERLK-JTQLQIEISA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide (CID 172595559) is (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide is CCCN(CC)C(=O)C1=C(F)[C@@H](F)CC=C1.
What is the InChIKey of (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide?
The InChIKey is IMZGXJVHUYERLK-JTQLQIEISA-N. The full InChI is InChI=1S/C12H17F2NO/c1-3-8-15(4-2)12(16)9-6-5-7-10(13)11(9)14/h5-6,10H,3-4,7-8H2,1-2H3/t10-/m0/s1.
What are the key properties of (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide?
(3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide has a molecular weight of 229.27 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-ethyl-2,3-difluoro-N-propylcyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 172595559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).