C19H16O9 — CID 172595882
(2R,3R,4S,6R)-3,4-dihydroxy-6-(8-hydroxy-6-oxobenzo[c]chromen-3-yl)oxyoxane-2-carboxylic acid (PubChem CID 172595882) has the molecular formula C19H16O9 and a molecular weight of 388.33 g/mol. Its IUPAC name is (2R,3R,4S,6R)-3,4-dihydroxy-6-(8-hydroxy-6-oxobenzo[c]chromen-3-yl)oxyoxane-2-carboxylic acid.
| Compound Name | (2R,3R,4S,6R)-3,4-dihydroxy-6-(8-hydroxy-6-oxobenzo[c]chromen-3-yl)oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 172595882 |
| Molecular Formula | C19H16O9 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (2R,3R,4S,6R)-3,4-dihydroxy-6-(8-hydroxy-6-oxobenzo[c]chromen-3-yl)oxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@H](Oc2ccc3c(c2)oc(=O)c2cc(O)ccc23)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H16O9/c20-8-1-3-10-11-4-2-9(6-14(11)27-19(25)12(10)5-8)26-15-7-13(21)16(22)17(28-15)18(23)24/h1-6,13,15-17,20-22H,7H2,(H,23,24)/t13-,15-,16+,17+/m0/s1 |
| InChIKey | FMWIBDDRKRSGPR-QMCVQRASSA-N |
| XLogP | 0.95 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|