C33H52BrFN4O3 — CID 172596143
(6R)-4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-fluoroquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol (PubChem CID 172596143) has the molecular formula C33H52BrFN4O3 and a molecular weight of 651.71 g/mol. Its IUPAC name is (6R)-4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-fluoroquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol.
| Compound Name | (6R)-4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-fluoroquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 172596143 |
| Molecular Formula | C33H52BrFN4O3 |
| Molecular Weight | 651.71 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | (6R)-4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-fluoroquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=C(F)c2nc(OCC(C)(CCCC)CCCCCC)nc(N3CCOC[C@](C)(O)C3)c2\1 |
| InChI | InChI=1S/C33H52BrFN4O3/c1-8-12-14-15-17-32(6,16-13-9-2)21-42-31-37-29-25(30(38-31)39-18-19-41-22-33(7,40)20-39)24(11-4)28(26(34)27(29)35)36-23(5)10-3/h11,23,40H,8-10,12-22H2,1-7H3/b24-11-,36-28-/t23?,32?,33-/m1/s1 |
| InChIKey | XNVFIXWVTVYQDG-RWZNUXFQSA-N |
| XLogP | 8.30 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.71 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|