C25H33BrClN5O2 — CID 172596193
tert-butyl 2-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 172596193) has the molecular formula C25H33BrClN5O2 and a molecular weight of 550.93 g/mol. Its IUPAC name is tert-butyl 2-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 172596193 |
| Molecular Formula | C25H33BrClN5O2 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | tert-butyl 2-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(Cl)nc(N3CC4CN(C(=O)OC(C)(C)C)CC4C3)c2\1 |
| InChI | InChI=1S/C25H33BrClN5O2/c1-7-14(3)28-21-17(8-2)20-19(9-18(21)26)29-23(27)30-22(20)31-10-15-12-32(13-16(15)11-31)24(33)34-25(4,5)6/h8-9,14-16H,7,10-13H2,1-6H3/b17-8-,28-21- |
| InChIKey | SCSXSKVHQSLHSN-FENNNXIPSA-N |
| XLogP | 5.83 |
| TPSA | 70.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|