C24H35BrClN5O — CID 172596305
(5Z)-7-bromo-2-chloro-5-ethylidene-4-[3-(3-methoxypropyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]quinazolin-6-imine;2-methylpropane (PubChem CID 172596305) has the molecular formula C24H35BrClN5O and a molecular weight of 524.94 g/mol. Its IUPAC name is (5Z)-7-bromo-2-chloro-5-ethylidene-4-[3-(3-methoxypropyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]quinazolin-6-imine;2-methylpropane.
| Compound Name | (5Z)-7-bromo-2-chloro-5-ethylidene-4-[3-(3-methoxypropyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]quinazolin-6-imine;2-methylpropane |
|---|---|
| PubChem CID | 172596305 |
| Molecular Formula | C24H35BrClN5O |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (5Z)-7-bromo-2-chloro-5-ethylidene-4-[3-(3-methoxypropyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]quinazolin-6-imine;2-methylpropane |
| SMILES | CC(C)C.[H]/N=C1\C(Br)=Cc2nc(Cl)nc(N3C4CCC3CN(CCCOC)C4)c2\C1=C\C |
| InChI | InChI=1S/C20H25BrClN5O.C4H10/c1-3-14-17-16(9-15(21)18(14)23)24-20(22)25-19(17)27-12-5-6-13(27)11-26(10-12)7-4-8-28-2;1-4(2)3/h3,9,12-13,23H,4-8,10-11H2,1-2H3;4H,1-3H3/b14-3-,23-18-; |
| InChIKey | RUARFAYUDBMWJS-WDGBDDJJSA-N |
| XLogP | 5.65 |
| TPSA | 65.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|