C42H61FN6O2 — CID 172596317
3-[(5Z)-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-fluoro-4-(6-methyl-1,4-oxazepan-4-yl)quinazolin-7-yl]-5-cyclopropyl-2-methanimidoylaniline (PubChem CID 172596317) has the molecular formula C42H61FN6O2 and a molecular weight of 700.99 g/mol. Its IUPAC name is 3-[(5Z)-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-fluoro-4-(6-methyl-1,4-oxazepan-4-yl)quinazolin-7-yl]-5-cyclopropyl-2-methanimidoylaniline.
| Compound Name | 3-[(5Z)-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-fluoro-4-(6-methyl-1,4-oxazepan-4-yl)quinazolin-7-yl]-5-cyclopropyl-2-methanimidoylaniline |
|---|---|
| PubChem CID | 172596317 |
| Molecular Formula | C42H61FN6O2 |
| Molecular Weight | 700.99 g/mol |
| Exact Mass | 700.48 |
| IUPAC Name | 3-[(5Z)-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-fluoro-4-(6-methyl-1,4-oxazepan-4-yl)quinazolin-7-yl]-5-cyclopropyl-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1c(N)cc(C2CC2)cc1C1=C(F)c2nc(OCC(C)(CCCC)CCCCC)nc(N3CCOCC(C)C3)c2C(=C/C)/C1=N\C(C)CC |
| InChI | InChI=1S/C42H61FN6O2/c1-8-12-14-18-42(7,17-13-9-2)26-51-41-47-39-36(40(48-41)49-19-20-50-25-27(5)24-49)31(11-4)38(46-28(6)10-3)35(37(39)43)32-21-30(29-15-16-29)22-34(45)33(32)23-44/h11,21-23,27-29,44H,8-10,12-20,24-26,45H2,1-7H3/b31-11-,44-23+,46-38+ |
| InChIKey | LGCMNQMXDRBHHA-CAJOJIJYSA-N |
| XLogP | 10.06 |
| TPSA | 109.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.99 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|