C33H49BrN6O3S — CID 172596506
tert-butyl 3-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;sulfane (PubChem CID 172596506) has the molecular formula C33H49BrN6O3S and a molecular weight of 689.77 g/mol. Its IUPAC name is tert-butyl 3-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;sulfane.
| Compound Name | tert-butyl 3-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;sulfane |
|---|---|
| PubChem CID | 172596506 |
| Molecular Formula | C33H49BrN6O3S |
| Molecular Weight | 689.77 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | tert-butyl 3-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate;sulfane |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC34CCCN3CCC4)nc(N3CC4CCC(C3)N4C(=O)OC(C)(C)C)c2\1.S |
| InChI | InChI=1S/C33H47BrN6O3.H2S/c1-7-21(3)35-28-24(8-2)27-26(17-25(28)34)36-30(42-20-33-13-9-15-39(33)16-10-14-33)37-29(27)38-18-22-11-12-23(19-38)40(22)31(41)43-32(4,5)6;/h8,17,21-23H,7,9-16,18-20H2,1-6H3;1H2/b24-8-,35-28-; |
| InChIKey | NYSLPJHXRGDLCW-IVRKFJJKSA-N |
| XLogP | 6.58 |
| TPSA | 83.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.77 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|