C16H19BrClKN4 — CID 172596571
potassium [(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-ethylazanide (PubChem CID 172596571) has the molecular formula C16H19BrClKN4 and a molecular weight of 421.81 g/mol. Its IUPAC name is potassium [(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-ethylazanide.
| Compound Name | potassium [(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-ethylazanide |
|---|---|
| PubChem CID | 172596571 |
| Molecular Formula | C16H19BrClKN4 |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | potassium [(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-ethylazanide |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(Cl)nc([N-]CC)c2\1.[K+] |
| InChI | InChI=1S/C16H19BrClN4.K/c1-5-9(4)20-14-10(6-2)13-12(8-11(14)17)21-16(18)22-15(13)19-7-3;/h6,8-9H,5,7H2,1-4H3;/q-1;+1/b10-6-,20-14-; |
| InChIKey | QTKKSSKDRWEXKP-PGBZREBGSA-N |
| XLogP | 2.55 |
| TPSA | 52.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|