About 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane
2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane (PubChem CID 172596729) has the molecular formula C9H9BrF3N3S
and a molecular weight of 328.16 g/mol. Its IUPAC name is 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane.
Molecular Properties
| Compound Name | 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane |
| PubChem CID | 172596729 |
| Molecular Formula | C9H9BrF3N3S |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane |
| SMILES | CC.FC(F)(F)c1cnc(-c2cnc(Br)s2)[nH]1 |
| InChI | InChI=1S/C7H3BrF3N3S.C2H6/c8-6-13-1-3(15-6)5-12-2-4(14-5)7(9,10)11;1-2/h1-2H,(H,12,14);1-2H3 |
| InChIKey | LORGLXOFWLTCFF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane?
The IUPAC name of 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane (CID 172596729) is 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane.
What is the SMILES notation for 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane?
The canonical SMILES for 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane is CC.FC(F)(F)c1cnc(-c2cnc(Br)s2)[nH]1.
What is the InChIKey of 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane?
The InChIKey is LORGLXOFWLTCFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrF3N3S.C2H6/c8-6-13-1-3(15-6)5-12-2-4(14-5)7(9,10)11;1-2/h1-2H,(H,12,14);1-2H3.
What are the key properties of 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane?
2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane has a molecular weight of 328.16 g/mol, XLogP of 4.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole;ethane is sourced from PubChem (CID 172596729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).