About N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine (PubChem CID 172596970) has the molecular formula C16H13Cl2FN2S2
and a molecular weight of 387.33 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine.
Molecular Properties
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine |
| PubChem CID | 172596970 |
| Molecular Formula | C16H13Cl2FN2S2 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine |
| SMILES | CSc1nc2ccc(F)c(N[C@H](C)c3ccc(Cl)cc3Cl)c2s1 |
| InChI | InChI=1S/C16H13Cl2FN2S2/c1-8(10-4-3-9(17)7-11(10)18)20-14-12(19)5-6-13-15(14)23-16(21-13)22-2/h3-8,20H,1-2H3/t8-/m1/s1 |
| InChIKey | UIXCMEUTNNAEOR-MRVPVSSYSA-N |
| XLogP | 6.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine?
The IUPAC name of N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine (CID 172596970) is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine.
What is the SMILES notation for N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine?
The canonical SMILES for N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine is CSc1nc2ccc(F)c(N[C@H](C)c3ccc(Cl)cc3Cl)c2s1.
What is the InChIKey of N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine?
The InChIKey is UIXCMEUTNNAEOR-MRVPVSSYSA-N. The full InChI is InChI=1S/C16H13Cl2FN2S2/c1-8(10-4-3-9(17)7-11(10)18)20-14-12(19)5-6-13-15(14)23-16(21-13)22-2/h3-8,20H,1-2H3/t8-/m1/s1.
What are the key properties of N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine?
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine has a molecular weight of 387.33 g/mol, XLogP of 6.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-fluoro-2-methylsulfanyl-1,3-benzothiazol-7-amine is sourced from PubChem (CID 172596970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).