About CID 172597432
CID 172597432 (PubChem CID 172597432) has the molecular formula C19H21BO
and a molecular weight of 276.19 g/mol.
Molecular Properties
| Compound Name | CID 172597432 |
| PubChem CID | 172597432 |
| Molecular Formula | C19H21BO |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | — |
| SMILES | [B]C1(O)C(/C=C\CC)=C(C=C)c2c1ccc(C)c2/C=C\C |
| InChI | InChI=1S/C19H21BO/c1-5-8-10-16-14(7-3)18-15(9-6-2)13(4)11-12-17(18)19(16,20)21/h6-12,21H,3,5H2,1-2,4H3/b9-6-,10-8- |
| InChIKey | ZQMUUDXDEKHSCJ-PTKGMRGESA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 172597432 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172597432?
The IUPAC name of CID 172597432 (CID 172597432) is not available.
What is the SMILES notation for CID 172597432?
The canonical SMILES for CID 172597432 is [B]C1(O)C(/C=C\CC)=C(C=C)c2c1ccc(C)c2/C=C\C.
What is the InChIKey of CID 172597432?
The InChIKey is ZQMUUDXDEKHSCJ-PTKGMRGESA-N. The full InChI is InChI=1S/C19H21BO/c1-5-8-10-16-14(7-3)18-15(9-6-2)13(4)11-12-17(18)19(16,20)21/h6-12,21H,3,5H2,1-2,4H3/b9-6-,10-8-.
What are the key properties of CID 172597432?
CID 172597432 has a molecular weight of 276.19 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172597432 is sourced from PubChem (CID 172597432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).