C65H85BN10O12P2S — CID 172597997
CID 172597997 (PubChem CID 172597997) has the molecular formula C65H85BN10O12P2S and a molecular weight of 1303.28 g/mol.
| Compound Name | CID 172597997 |
|---|---|
| PubChem CID | 172597997 |
| Molecular Formula | C65H85BN10O12P2S |
| Molecular Weight | 1303.28 g/mol |
| Exact Mass | 1302.56 |
| IUPAC Name | — |
| SMILES | CC.N/C1=C(\NCc2ccccc2)c2ccccc2CN(C(=O)CCNC(=O)CCN2C(=O)CC(SCCCCCCOP(O)O)C2=O)c2ccccc21.[B]N(N)/C1=C(\N)c2ccccc2N(C(=O)CCC(=O)NCCCCCCOP(O)O)Cc2ccccc21 |
| InChI | InChI=1S/C38H46N5O7PS.C25H33BN5O5P.C2H6/c39-36-30-16-8-9-17-31(30)43(26-28-14-6-7-15-29(28)37(36)41-25-27-12-4-3-5-13-27)34(45)18-20-40-33(44)19-21-42-35(46)24-32(38(42)47)52-23-11-2-1-10-22-50-51(48)49;26-31(28)25-19-10-4-3-9-18(19)17-30(21-12-6-5-11-20(21)24(25)27)23(33)14-13-22(32)29-15-7-1-2-8-16-36-37(34)35;1-2/h3-9,12-17,32,41,48-49H,1-2,10-11,18-26,39H2,(H,40,44);3-6,9-12,34-35H,1-2,7-8,13-17,27-28H2,(H,29,32);1-2H3/b37-36-;25-24-; |
| InChIKey | FEHKIANNLDLIBL-RVXXVNIRSA-N |
| XLogP | 7.94 |
| TPSA | 328.91 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 91 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1303.28 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|