C19H36N4O4 — CID 172598050
butanal;1-(1-butanoylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxamide;methanamine (PubChem CID 172598050) has the molecular formula C19H36N4O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is butanal;1-(1-butanoylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxamide;methanamine.
| Compound Name | butanal;1-(1-butanoylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxamide;methanamine |
|---|---|
| PubChem CID | 172598050 |
| Molecular Formula | C19H36N4O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | butanal;1-(1-butanoylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxamide;methanamine |
| SMILES | CCCC(=O)N1CCCC1C(=O)N1CCCC1C(N)=O.CCCC=O.CN |
| InChI | InChI=1S/C14H23N3O3.C4H8O.CH5N/c1-2-5-12(18)16-8-4-7-11(16)14(20)17-9-3-6-10(17)13(15)19;1-2-3-4-5;1-2/h10-11H,2-9H2,1H3,(H2,15,19);4H,2-3H2,1H3;2H2,1H3 |
| InChIKey | WYTHCNZKYGTXHR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|