C58H79BN10O12P2S — CID 172598064
CID 172598064 (PubChem CID 172598064) has the molecular formula C58H79BN10O12P2S and a molecular weight of 1213.15 g/mol.
| Compound Name | CID 172598064 |
|---|---|
| PubChem CID | 172598064 |
| Molecular Formula | C58H79BN10O12P2S |
| Molecular Weight | 1213.15 g/mol |
| Exact Mass | 1212.52 |
| IUPAC Name | — |
| SMILES | CC.N/C1=C(\N)c2ccccc2N(C(=O)CCC(=O)NCCCCCCOP(O)O)Cc2ccccc21.[B]N(N)/C1=C(\N)c2ccccc2N(C(=O)CCNC(=O)CCN2C(=O)CC(SCCCCCCOP(O)O)C2=O)Cc2ccccc21 |
| InChI | InChI=1S/C31H40BN6O7PS.C25H33N4O5P.C2H6/c32-38(34)30-22-10-4-3-9-21(22)20-37(24-12-6-5-11-23(24)29(30)33)27(40)13-15-35-26(39)14-16-36-28(41)19-25(31(36)42)47-18-8-2-1-7-17-45-46(43)44;26-24-19-10-4-3-9-18(19)17-29(21-12-6-5-11-20(21)25(24)27)23(31)14-13-22(30)28-15-7-1-2-8-16-34-35(32)33;1-2/h3-6,9-12,25,43-44H,1-2,7-8,13-20,33-34H2,(H,35,39);3-6,9-12,32-33H,1-2,7-8,13-17,26-27H2,(H,28,30);1-2H3/b30-29-;25-24-; |
| InChIKey | MKEZURCJHBGABG-ZCJMEVMISA-N |
| XLogP | 6.11 |
| TPSA | 342.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 84 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1213.15 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|