C19H21IN4O2 — CID 172598846
4-iodo-5-[[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile (PubChem CID 172598846) has the molecular formula C19H21IN4O2 and a molecular weight of 464.31 g/mol. Its IUPAC name is 4-iodo-5-[[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile.
| Compound Name | 4-iodo-5-[[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 172598846 |
| Molecular Formula | C19H21IN4O2 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-iodo-5-[[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc2c(I)c(NC3CCC(N4CC5(COC5)C4)CC3)ncc2o1 |
| InChI | InChI=1S/C19H21IN4O2/c20-17-15-5-14(6-21)26-16(15)7-22-18(17)23-12-1-3-13(4-2-12)24-8-19(9-24)10-25-11-19/h5,7,12-13H,1-4,8-11H2,(H,22,23) |
| InChIKey | AMAFKVILCMSVES-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|