About 5-bromofuro[2,3-c]pyridine-2-carboxamide
5-bromofuro[2,3-c]pyridine-2-carboxamide (PubChem CID 172599017) has the molecular formula C8H5BrN2O2
and a molecular weight of 241.04 g/mol. Its IUPAC name is 5-bromofuro[2,3-c]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromofuro[2,3-c]pyridine-2-carboxamide |
| PubChem CID | 172599017 |
| Molecular Formula | C8H5BrN2O2 |
| Molecular Weight | 241.04 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 5-bromofuro[2,3-c]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(Br)ncc2o1 |
| InChI | InChI=1S/C8H5BrN2O2/c9-7-2-4-1-5(8(10)12)13-6(4)3-11-7/h1-3H,(H2,10,12) |
| InChIKey | UCOVSFIGSZWJJL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.04 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromofuro[2,3-c]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromofuro[2,3-c]pyridine-2-carboxamide?
The IUPAC name of 5-bromofuro[2,3-c]pyridine-2-carboxamide (CID 172599017) is 5-bromofuro[2,3-c]pyridine-2-carboxamide.
What is the SMILES notation for 5-bromofuro[2,3-c]pyridine-2-carboxamide?
The canonical SMILES for 5-bromofuro[2,3-c]pyridine-2-carboxamide is NC(=O)c1cc2cc(Br)ncc2o1.
What is the InChIKey of 5-bromofuro[2,3-c]pyridine-2-carboxamide?
The InChIKey is UCOVSFIGSZWJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O2/c9-7-2-4-1-5(8(10)12)13-6(4)3-11-7/h1-3H,(H2,10,12).
What are the key properties of 5-bromofuro[2,3-c]pyridine-2-carboxamide?
5-bromofuro[2,3-c]pyridine-2-carboxamide has a molecular weight of 241.04 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromofuro[2,3-c]pyridine-2-carboxamide is sourced from PubChem (CID 172599017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).