About 7-bromofuro[2,3-c]quinoline-2-carbonitrile
7-bromofuro[2,3-c]quinoline-2-carbonitrile (PubChem CID 172599368) has the molecular formula C12H5BrN2O
and a molecular weight of 273.09 g/mol. Its IUPAC name is 7-bromofuro[2,3-c]quinoline-2-carbonitrile.
Molecular Properties
| Compound Name | 7-bromofuro[2,3-c]quinoline-2-carbonitrile |
| PubChem CID | 172599368 |
| Molecular Formula | C12H5BrN2O |
| Molecular Weight | 273.09 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 7-bromofuro[2,3-c]quinoline-2-carbonitrile |
| SMILES | N#Cc1cc2c(cnc3cc(Br)ccc32)o1 |
| InChI | InChI=1S/C12H5BrN2O/c13-7-1-2-9-10-4-8(5-14)16-12(10)6-15-11(9)3-7/h1-4,6H |
| InChIKey | UARWYFJSBUPRRU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.09 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromofuro[2,3-c]quinoline-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromofuro[2,3-c]quinoline-2-carbonitrile?
The IUPAC name of 7-bromofuro[2,3-c]quinoline-2-carbonitrile (CID 172599368) is 7-bromofuro[2,3-c]quinoline-2-carbonitrile.
What is the SMILES notation for 7-bromofuro[2,3-c]quinoline-2-carbonitrile?
The canonical SMILES for 7-bromofuro[2,3-c]quinoline-2-carbonitrile is N#Cc1cc2c(cnc3cc(Br)ccc32)o1.
What is the InChIKey of 7-bromofuro[2,3-c]quinoline-2-carbonitrile?
The InChIKey is UARWYFJSBUPRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5BrN2O/c13-7-1-2-9-10-4-8(5-14)16-12(10)6-15-11(9)3-7/h1-4,6H.
What are the key properties of 7-bromofuro[2,3-c]quinoline-2-carbonitrile?
7-bromofuro[2,3-c]quinoline-2-carbonitrile has a molecular weight of 273.09 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromofuro[2,3-c]quinoline-2-carbonitrile is sourced from PubChem (CID 172599368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).