C21H24BrN5O2 — CID 172599466
4-bromo-5-[[4-(4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile (PubChem CID 172599466) has the molecular formula C21H24BrN5O2 and a molecular weight of 458.36 g/mol. Its IUPAC name is 4-bromo-5-[[4-(4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile.
| Compound Name | 4-bromo-5-[[4-(4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 172599466 |
| Molecular Formula | C21H24BrN5O2 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 4-bromo-5-[[4-(4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl)cyclohexyl]amino]furo[2,3-c]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc2c(Br)c(NC3CCC(N4CC5CCNC(=O)C5C4)CC3)ncc2o1 |
| InChI | InChI=1S/C21H24BrN5O2/c22-19-16-7-15(8-23)29-18(16)9-25-20(19)26-13-1-3-14(4-2-13)27-10-12-5-6-24-21(28)17(12)11-27/h7,9,12-14,17H,1-6,10-11H2,(H,24,28)(H,25,26) |
| InChIKey | ZTCGFHHWHOIICA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |