C24H32BrFN4O2 — CID 172599684
4-bromo-5-(cyclohexylamino)furo[2,3-c]pyridine-2-carbonitrile;ethene;N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine (PubChem CID 172599684) has the molecular formula C24H32BrFN4O2 and a molecular weight of 507.45 g/mol. Its IUPAC name is 4-bromo-5-(cyclohexylamino)furo[2,3-c]pyridine-2-carbonitrile;ethene;N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine.
| Compound Name | 4-bromo-5-(cyclohexylamino)furo[2,3-c]pyridine-2-carbonitrile;ethene;N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 172599684 |
| Molecular Formula | C24H32BrFN4O2 |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 4-bromo-5-(cyclohexylamino)furo[2,3-c]pyridine-2-carbonitrile;ethene;N-fluoro-N-methyl-2-[(3E)-penta-1,3-dien-3-yl]oxyethanamine |
| SMILES | C=C.C=C/C(=C\C)OCCN(C)F.N#Cc1cc2c(Br)c(NC3CCCCC3)ncc2o1 |
| InChI | InChI=1S/C14H14BrN3O.C8H14FNO.C2H4/c15-13-11-6-10(7-16)19-12(11)8-17-14(13)18-9-4-2-1-3-5-9;1-4-8(5-2)11-7-6-10(3)9;1-2/h6,8-9H,1-5H2,(H,17,18);4-5H,1,6-7H2,2-3H3;1-2H2/b;8-5+; |
| InChIKey | MDXTXDASDFPTAN-UKXMSUEASA-N |
| XLogP | 6.92 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|