C27H25N5O3S — CID 172600003
4-[[5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]-2,6-naphthyridin-3-yl]amino]benzenesulfonic acid (PubChem CID 172600003) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 4-[[5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]-2,6-naphthyridin-3-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]-2,6-naphthyridin-3-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 172600003 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 4-[[5-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethynyl]-2,6-naphthyridin-3-yl]amino]benzenesulfonic acid |
| SMILES | CN1CCN(c2ccc(C#Cc3nccc4cnc(Nc5ccc(S(=O)(=O)O)cc5)cc34)cc2)CC1 |
| InChI | InChI=1S/C27H25N5O3S/c1-31-14-16-32(17-15-31)23-7-2-20(3-8-23)4-11-26-25-18-27(29-19-21(25)12-13-28-26)30-22-5-9-24(10-6-22)36(33,34)35/h2-3,5-10,12-13,18-19H,14-17H2,1H3,(H,29,30)(H,33,34,35) |
| InChIKey | JCZWMFGXNUTEJY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|