C14H19N — CID 172600376
ethane;6-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 172600376) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;6-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | ethane;6-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 172600376 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | ethane;6-prop-1-ynyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC.CC#Cc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C12H13N.C2H6/c1-2-3-10-4-5-12-9-13-7-6-11(12)8-10;1-2/h4-5,8,13H,6-7,9H2,1H3;1-2H3 |
| InChIKey | FCVOLPVVXMHYFT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|