C29H24N4OS — CID 172600481
6-[2-[7-(4-cyclopropylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one (PubChem CID 172600481) has the molecular formula C29H24N4OS and a molecular weight of 476.61 g/mol. Its IUPAC name is 6-[2-[7-(4-cyclopropylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 6-[2-[7-(4-cyclopropylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 172600481 |
| Molecular Formula | C29H24N4OS |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 6-[2-[7-(4-cyclopropylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2cc(C#Cc3nccc4cnc(Nc5ccc(SC6CC6)cc5)cc34)ccc21 |
| InChI | InChI=1S/C29H24N4OS/c1-29(2)24-11-3-18(15-26(24)33-28(29)34)4-12-25-23-16-27(31-17-19(23)13-14-30-25)32-20-5-7-21(8-6-20)35-22-9-10-22/h3,5-8,11,13-17,22H,9-10H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | XMQCCVLZJCQSMT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|