About 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine
6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 172601543) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 172601543 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | C/N=C/C1=C(N)C(C)=CCC1 |
| InChI | InChI=1S/C9H14N2/c1-7-4-3-5-8(6-11-2)9(7)10/h4,6H,3,5,10H2,1-2H3/b11-6+ |
| InChIKey | NSUWBNOWCSTEAZ-IZZDOVSWSA-N |
| XLogP | 1.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine (CID 172601543) is 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine is C/N=C/C1=C(N)C(C)=CCC1.
What is the InChIKey of 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine?
The InChIKey is NSUWBNOWCSTEAZ-IZZDOVSWSA-N. The full InChI is InChI=1S/C9H14N2/c1-7-4-3-5-8(6-11-2)9(7)10/h4,6H,3,5,10H2,1-2H3/b11-6+.
What are the key properties of 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine?
6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine has a molecular weight of 150.22 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(methyliminomethyl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 172601543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).