About 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid
3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid (PubChem CID 172603073) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid |
| PubChem CID | 172603073 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid |
| SMILES | CC(C)c1ccc2c(c1)CC(c1cccc(C(=O)O)c1)O2 |
| InChI | InChI=1S/C18H18O3/c1-11(2)12-6-7-16-15(8-12)10-17(21-16)13-4-3-5-14(9-13)18(19)20/h3-9,11,17H,10H2,1-2H3,(H,19,20) |
| InChIKey | DJDZEIWWRUQNDK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid?
The IUPAC name of 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid (CID 172603073) is 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid.
What is the SMILES notation for 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid?
The canonical SMILES for 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid is CC(C)c1ccc2c(c1)CC(c1cccc(C(=O)O)c1)O2.
What is the InChIKey of 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid?
The InChIKey is DJDZEIWWRUQNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c1-11(2)12-6-7-16-15(8-12)10-17(21-16)13-4-3-5-14(9-13)18(19)20/h3-9,11,17H,10H2,1-2H3,(H,19,20).
What are the key properties of 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid?
3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid has a molecular weight of 282.34 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-propan-2-yl-2,3-dihydro-1-benzofuran-2-yl)benzoic acid is sourced from PubChem (CID 172603073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).