About 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane
2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane (PubChem CID 172604301) has the molecular formula C8H20N2O2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane.
Molecular Properties
| Compound Name | 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane |
| PubChem CID | 172604301 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane |
| SMILES | CC.CN(C)C(=O)COCCN |
| InChI | InChI=1S/C6H14N2O2.C2H6/c1-8(2)6(9)5-10-4-3-7;1-2/h3-5,7H2,1-2H3;1-2H3 |
| InChIKey | LYAUZJZTZPOZBQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane?
The IUPAC name of 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane (CID 172604301) is 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane.
What is the SMILES notation for 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane?
The canonical SMILES for 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane is CC.CN(C)C(=O)COCCN.
What is the InChIKey of 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane?
The InChIKey is LYAUZJZTZPOZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2.C2H6/c1-8(2)6(9)5-10-4-3-7;1-2/h3-5,7H2,1-2H3;1-2H3.
What are the key properties of 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane?
2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane has a molecular weight of 176.26 g/mol, XLogP of 0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)-N,N-dimethylacetamide;ethane is sourced from PubChem (CID 172604301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).