C17H25N3O4 — CID 172604910
N,N-dimethylethanamine;2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde (PubChem CID 172604910) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde.
| Compound Name | N,N-dimethylethanamine;2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde |
|---|---|
| PubChem CID | 172604910 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N,N-dimethylethanamine;2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde |
| SMILES | CCN(C)C.Cc1ccc(OCC=O)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O4.C4H11N/c1-9-2-3-10(19-7-6-16)8-11(9)15-5-4-12(17)14-13(15)18;1-4-5(2)3/h2-3,6,8H,4-5,7H2,1H3,(H,14,17,18);4H2,1-3H3 |
| InChIKey | PRBUIEPHALNIBP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|