C11H18N2O3 — CID 172605125
ethane;1-[(3Z)-4-hydroxypenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 172605125) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethane;1-[(3Z)-4-hydroxypenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-[(3Z)-4-hydroxypenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 172605125 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethane;1-[(3Z)-4-hydroxypenta-1,3-dien-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C(=C(\C)O)N1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C9H12N2O3.C2H6/c1-3-7(6(2)12)11-5-4-8(13)10-9(11)14;1-2/h3,12H,1,4-5H2,2H3,(H,10,13,14);1-2H3/b7-6-; |
| InChIKey | RPRJDDRYEACMFQ-NAFXZHHSSA-N |
| XLogP | 1.93 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|