About 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline
4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline (PubChem CID 172605484) has the molecular formula C12H9BrFNO
and a molecular weight of 282.11 g/mol. Its IUPAC name is 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline.
Molecular Properties
| Compound Name | 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline |
| PubChem CID | 172605484 |
| Molecular Formula | C12H9BrFNO |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline |
| SMILES | FCc1ccc2c3c(c(Br)nc2c1)COC3 |
| InChI | InChI=1S/C12H9BrFNO/c13-12-10-6-16-5-9(10)8-2-1-7(4-14)3-11(8)15-12/h1-3H,4-6H2 |
| InChIKey | OSGXSHQIYFXFGW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline?
The IUPAC name of 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline (CID 172605484) is 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline.
What is the SMILES notation for 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline?
The canonical SMILES for 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline is FCc1ccc2c3c(c(Br)nc2c1)COC3.
What is the InChIKey of 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline?
The InChIKey is OSGXSHQIYFXFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrFNO/c13-12-10-6-16-5-9(10)8-2-1-7(4-14)3-11(8)15-12/h1-3H,4-6H2.
What are the key properties of 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline?
4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline has a molecular weight of 282.11 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-(fluoromethyl)-1,3-dihydrofuro[3,4-c]quinoline is sourced from PubChem (CID 172605484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).