About (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol
(2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol (PubChem CID 172605601) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol |
| PubChem CID | 172605601 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol |
| SMILES | C=C/C(CO)=C(\C=C)SC |
| InChI | InChI=1S/C8H12OS/c1-4-7(6-9)8(5-2)10-3/h4-5,9H,1-2,6H2,3H3/b8-7- |
| InChIKey | GXFWHQMMFMCGNM-FPLPWBNLSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol?
The IUPAC name of (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol (CID 172605601) is (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol.
What is the SMILES notation for (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol?
The canonical SMILES for (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol is C=C/C(CO)=C(\C=C)SC.
What is the InChIKey of (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol?
The InChIKey is GXFWHQMMFMCGNM-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H12OS/c1-4-7(6-9)8(5-2)10-3/h4-5,9H,1-2,6H2,3H3/b8-7-.
What are the key properties of (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol?
(2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol has a molecular weight of 156.25 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethenyl-3-methylsulfanylpenta-2,4-dien-1-ol is sourced from PubChem (CID 172605601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).