About [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate
[1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate (PubChem CID 172606863) has the molecular formula C12H16F5NO3
and a molecular weight of 317.25 g/mol. Its IUPAC name is [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate.
Molecular Properties
| Compound Name | [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate |
| PubChem CID | 172606863 |
| Molecular Formula | C12H16F5NO3 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate |
| SMILES | COC=O.O=C(N1CCC(F)C1)C1(C(F)F)CC(F)(F)C1 |
| InChI | InChI=1S/C10H12F5NO.C2H4O2/c11-6-1-2-16(3-6)8(17)9(7(12)13)4-10(14,15)5-9;1-4-2-3/h6-7H,1-5H2;2H,1H3 |
| InChIKey | ISUBLPOGXDBXPB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate?
The IUPAC name of [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate (CID 172606863) is [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate.
What is the SMILES notation for [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate?
The canonical SMILES for [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate is COC=O.O=C(N1CCC(F)C1)C1(C(F)F)CC(F)(F)C1.
What is the InChIKey of [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate?
The InChIKey is ISUBLPOGXDBXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F5NO.C2H4O2/c11-6-1-2-16(3-6)8(17)9(7(12)13)4-10(14,15)5-9;1-4-2-3/h6-7H,1-5H2;2H,1H3.
What are the key properties of [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate?
[1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate has a molecular weight of 317.25 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(difluoromethyl)-3,3-difluorocyclobutyl]-(3-fluoropyrrolidin-1-yl)methanone;methyl formate is sourced from PubChem (CID 172606863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).