About (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine
(E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine (PubChem CID 172607148) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine |
| PubChem CID | 172607148 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine |
| SMILES | C=C/C=N\C(=C(\C)C(C)C)N(C)N=C |
| InChI | InChI=1S/C11H19N3/c1-7-8-13-11(14(6)12-5)10(4)9(2)3/h7-9H,1,5H2,2-4,6H3/b11-10+,13-8- |
| InChIKey | MKMPWYKUVPKVOD-QRRHERDPSA-N |
| XLogP | 2.68 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine?
The IUPAC name of (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine (CID 172607148) is (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine.
What is the SMILES notation for (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine?
The canonical SMILES for (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine is C=C/C=N\C(=C(\C)C(C)C)N(C)N=C.
What is the InChIKey of (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine?
The InChIKey is MKMPWYKUVPKVOD-QRRHERDPSA-N. The full InChI is InChI=1S/C11H19N3/c1-7-8-13-11(14(6)12-5)10(4)9(2)3/h7-9H,1,5H2,2-4,6H3/b11-10+,13-8-.
What are the key properties of (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine?
(E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine has a molecular weight of 193.29 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,2,3-trimethyl-N-(methylideneamino)-1-[(Z)-prop-2-enylideneamino]but-1-en-1-amine is sourced from PubChem (CID 172607148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).