C16H20F3N3O4S — CID 172607981
5-[3-[(5R)-5-(4,4-difluorobutyl)-2,5-dihydro-1H-pyrrol-3-yl]-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-ol (PubChem CID 172607981) has the molecular formula C16H20F3N3O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is 5-[3-[(5R)-5-(4,4-difluorobutyl)-2,5-dihydro-1H-pyrrol-3-yl]-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-ol.
| Compound Name | 5-[3-[(5R)-5-(4,4-difluorobutyl)-2,5-dihydro-1H-pyrrol-3-yl]-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-ol |
|---|---|
| PubChem CID | 172607981 |
| Molecular Formula | C16H20F3N3O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 5-[3-[(5R)-5-(4,4-difluorobutyl)-2,5-dihydro-1H-pyrrol-3-yl]-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-ol |
| SMILES | O=S1(=O)NC(O)CN1c1c(O)ccc(C2=C[C@@H](CCCC(F)F)NC2)c1F |
| InChI | InChI=1S/C16H20F3N3O4S/c17-13(18)3-1-2-10-6-9(7-20-10)11-4-5-12(23)16(15(11)19)22-8-14(24)21-27(22,25)26/h4-6,10,13-14,20-21,23-24H,1-3,7-8H2/t10-,14?/m1/s1 |
| InChIKey | BGDRYXYWSQVKER-IAPIXIRKSA-N |
| XLogP | 1.29 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |