C16H32N4O2 — CID 172608270
(E,2S,11S)-11-amino-N',2,11-trimethyl-2-(methylamino)dodec-6-enediamide (PubChem CID 172608270) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (E,2S,11S)-11-amino-N',2,11-trimethyl-2-(methylamino)dodec-6-enediamide.
| Compound Name | (E,2S,11S)-11-amino-N',2,11-trimethyl-2-(methylamino)dodec-6-enediamide |
|---|---|
| PubChem CID | 172608270 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (E,2S,11S)-11-amino-N',2,11-trimethyl-2-(methylamino)dodec-6-enediamide |
| SMILES | CNC(=O)[C@@](C)(N)CCC/C=C/CCC[C@](C)(NC)C(N)=O |
| InChI | InChI=1S/C16H32N4O2/c1-15(18,14(22)19-3)11-9-7-5-6-8-10-12-16(2,20-4)13(17)21/h5-6,20H,7-12,18H2,1-4H3,(H2,17,21)(H,19,22)/b6-5+/t15-,16-/m0/s1 |
| InChIKey | FIDQQNAIAQIMSH-DKLOGILVSA-N |
| XLogP | 0.81 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|